Y-29794 structure
|
Common Name | Y-29794 | ||
|---|---|---|---|---|
| CAS Number | 2554621-98-4 | Molecular Weight | 404.63 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H32N2OS2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Y-29794Y-29794 (Compound 2) is a potent, covalent prolyl oligopeptidase (POP) inhibitor with a Ki of 0.95 nM. Y-29794 can be used for studying neurodegenerative diseases and cancer[1]. |
| Name | Y-29794 |
|---|
| Description | Y-29794 (Compound 2) is a potent, covalent prolyl oligopeptidase (POP) inhibitor with a Ki of 0.95 nM. Y-29794 can be used for studying neurodegenerative diseases and cancer[1]. |
|---|---|
| Related Catalog | |
| Target |
IC50: 0.95 nM (POP)[1] |
| References |
| Molecular Formula | C22H32N2OS2 |
|---|---|
| Molecular Weight | 404.63 |
| InChIKey | GIXYZTSUAFPXJL-UHFFFAOYSA-N |
| SMILES | CC(C)c1ccc(C(=O)c2cccs2)c(SCCCCCCCN(C)C)n1 |