Bruceine B
Modify Date: 2025-08-22 19:28:21
Bruceine B structure
|
Common Name | Bruceine B | ||
|---|---|---|---|---|
| CAS Number | 25514-29-8 | Molecular Weight | 480.46200 | |
| Density | 1.52g/cm3 | Boiling Point | 701.8ºC at 760 mmHg | |
| Molecular Formula | C23H28O11 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 241.4ºC | |
Use of Bruceine BBruceine B inhibits protein synthesis and nucleic acid synthesis[1]. |
| Name | Bruceine B |
|---|
| Description | Bruceine B inhibits protein synthesis and nucleic acid synthesis[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Bruceine B exhibits an IC50 of 10 nM for antimalarial activity[1]. |
| References |
| Density | 1.52g/cm3 |
|---|---|
| Boiling Point | 701.8ºC at 760 mmHg |
| Molecular Formula | C23H28O11 |
| Molecular Weight | 480.46200 |
| Flash Point | 241.4ºC |
| Exact Mass | 480.16300 |
| PSA | 165.89000 |
| Vapour Pressure | 9.01E-23mmHg at 25°C |
| Index of Refraction | 1.615 |
| InChIKey | YDWODLQEUPYKGJ-LZFWDZGBSA-N |
| SMILES | COC(=O)C12OCC34C(CC5C(C)=C(O)C(=O)CC5(C)C3C(O)C1O)OC(=O)C(OC(C)=O)C24 |
|
~%
Bruceine B CAS#:25514-29-8 |
| Literature: Yoshimura; Sakaki; Ishibashi; et al. Bulletin of the Chemical Society of Japan, 1985 , vol. 58, # 9 p. 2673 - 2679 |
|
~%
Bruceine B CAS#:25514-29-8 |
| Literature: Murakarni, Nobutoshi; Umezome, Takashi; Mahmud, Taifo; Sugimoto, Masanori; Kobayashi, Motomasa; Wataya, Yusuke; Kim, Hye-Sook Bioorganic and Medicinal Chemistry Letters, 1998 , vol. 8, # 5 p. 459 - 462 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |