1H, 1H,2H-PERFLUORONON-1-ENE structure
|
Common Name | 1H, 1H,2H-PERFLUORONON-1-ENE | ||
|---|---|---|---|---|
| CAS Number | 25431-45-2 | Molecular Weight | 396.09600 | |
| Density | 1.557 g/cm3 | Boiling Point | 122.8ºC at 760 mmHg | |
| Molecular Formula | C9H3F15 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,3,4,4,5,5,6,6,7,7,8,8,9,9,9-pentadecafluoronon-1-ene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.557 g/cm3 |
|---|---|
| Boiling Point | 122.8ºC at 760 mmHg |
| Molecular Formula | C9H3F15 |
| Molecular Weight | 396.09600 |
| Exact Mass | 396.00000 |
| LogP | 5.54650 |
| Vapour Pressure | 16.6mmHg at 25°C |
| Index of Refraction | 1.287 |
| InChIKey | RXZWAMINHJDYKW-UHFFFAOYSA-N |
| SMILES | C=CC(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)C(F)(F)F |
| Hazard Codes | Xi: Irritant; |
|---|---|
| HS Code | 2903399090 |
| HS Code | 2903399090 |
|---|---|
| Summary | 2903399090. brominated,fluorinated or iodinated derivatives of acyclic hydrocarbons. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
| EINECS 246-976-3 |
| PC6128 |
| 1H,1H,2H-Perfluoronon-1-ene |