Thiourea,N-(2,2-diethoxyethyl)-N'-phenyl- structure
|
Common Name | Thiourea,N-(2,2-diethoxyethyl)-N'-phenyl- | ||
|---|---|---|---|---|
| CAS Number | 25373-43-7 | Molecular Weight | 268.37500 | |
| Density | 1.142g/cm3 | Boiling Point | 362.4ºC at 760mmHg | |
| Molecular Formula | C13H20N2O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 173ºC | |
| Name | 1-(2,2-diethoxyethyl)-3-phenylthiourea |
|---|---|
| Synonym | More Synonyms |
| Density | 1.142g/cm3 |
|---|---|
| Boiling Point | 362.4ºC at 760mmHg |
| Molecular Formula | C13H20N2O2S |
| Molecular Weight | 268.37500 |
| Flash Point | 173ºC |
| Exact Mass | 268.12500 |
| PSA | 74.61000 |
| LogP | 2.83600 |
| Vapour Pressure | 1.93E-05mmHg at 25°C |
| Index of Refraction | 1.578 |
| InChIKey | UDXFOMCTFSUKOL-UHFFFAOYSA-N |
| SMILES | CCOC(CNC(=S)Nc1ccccc1)OCC |
|
~%
Thiourea,N-(2,2... CAS#:25373-43-7 |
| Literature: Yamada; Yura; Morimoto; Harada; Honma; Kinoshita; Sugiura Journal of Medicinal Chemistry, 1996 , vol. 39, # 2 p. 596 - 604 |
|
~%
Thiourea,N-(2,2... CAS#:25373-43-7 |
| Literature: Easson; Pyman Journal of the Chemical Society, 1932 , p. 1806,1809 |
|
~%
Thiourea,N-(2,2... CAS#:25373-43-7 |
| Literature: Yamada; Yura; Morimoto; Harada; Honma; Kinoshita; Sugiura Journal of Medicinal Chemistry, 1996 , vol. 39, # 2 p. 596 - 604 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| N-Phenyl-N'-acetalyl-thioharnstoff |
| N-(2,2-Diaethoxy-aethyl)-N'-phenyl-thioharnstoff |
| N-(2,2-diethoxy-ethyl)-N'-phenyl-thiourea |