1-(3-Trifluoromethylphenyl)imidazole
Modify Date: 2025-08-26 11:14:50
1-(3-Trifluoromethylphenyl)imidazole structure
|
Common Name | 1-(3-Trifluoromethylphenyl)imidazole | ||
|---|---|---|---|---|
| CAS Number | 25371-97-5 | Molecular Weight | 212.171 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 282.7±40.0 °C at 760 mmHg | |
| Molecular Formula | C10H7F3N2 | Melting Point | 71ºC | |
| MSDS | N/A | Flash Point | 124.8±27.3 °C | |
| Name | 1-(3-Trifluoromethylphenyl)imidazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 282.7±40.0 °C at 760 mmHg |
| Melting Point | 71ºC |
| Molecular Formula | C10H7F3N2 |
| Molecular Weight | 212.171 |
| Flash Point | 124.8±27.3 °C |
| Exact Mass | 212.056137 |
| PSA | 17.82000 |
| LogP | 2.55 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.522 |
| InChIKey | KZVUPVJLOACZIL-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1cccc(-n2ccnc2)c1 |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | S26-S36/37/39 |
| HS Code | 2933290090 |
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-[3-(Trifluoromethyl)phenyl]-1H-imidazole |
| MFCD00060487 |
| Imidazole, 1-(3-trifluoromethylphenyl)- |
| 1-[3-(trifluoromethyl)phenyl]imidazole |
| 1H-Imidazole, 1-[3-(trifluoromethyl)phenyl]- |