isocalamendiol structure
|
Common Name | isocalamendiol | ||
|---|---|---|---|---|
| CAS Number | 25330-21-6 | Molecular Weight | 238.366 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 342.2±42.0 °C at 760 mmHg | |
| Molecular Formula | C15H26O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 153.3±22.5 °C | |
| Name | (1R,4S,4aR,8aS)-4-Isopropyl-1-methyl-6-methyleneoctahydro-1,4a(2H )-naphthalenediol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 342.2±42.0 °C at 760 mmHg |
| Molecular Formula | C15H26O2 |
| Molecular Weight | 238.366 |
| Flash Point | 153.3±22.5 °C |
| Exact Mass | 238.193283 |
| PSA | 40.46000 |
| LogP | 3.34 |
| Vapour Pressure | 0.0±1.7 mmHg at 25°C |
| Index of Refraction | 1.517 |
| InChIKey | AHNGXHRYFGQWSL-BYNSBNAKSA-N |
| SMILES | C=C1CCC2C(C)(O)CCC(C(C)C)C2(O)C1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2906199090 |
|
~%
isocalamendiol CAS#:25330-21-6 |
| Literature: Niwa,M. et al. Bulletin of the Chemical Society of Japan, 1976 , vol. 49, p. 3148 - 3150 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2906199090 |
|---|---|
| Summary | 2906199090. cyclanic, cyclenic or cyclotherpenic alcohols. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:5.5%. General tariff:30.0% |
| 1,9-Trimethylxanthine |
| 1,4a(2H)-Naphthalenediol, octahydro-1-methyl-6-methylene-4-(1-methylethyl)-, (1R,4S,4aR,8aS)- |
| 2,6-Dihydroxy-1,3,9-trimethylpurine |
| isocalamendiol |
| ISOCAFFIENE |
| 1,3,9-Trimethylxanthine |
| isocalamediol |
| isocalamenediol |
| 1,3,9-trimethyl-3,9-dihydro-purine-2,6-dione |
| Isocalomendiol |
| (1R,4S,4aR,8aS)-4-Isopropyl-1-methyl-6-methyleneoctahydro-1,4a(2H)-naphthalenediol |
| 1,3,9-Trimethyl-3,9-dihydro-purin-2,6-dion |
| isocaffeine |