Benzenesulfonic acid,2-nitro-, 4-(1,1-dimethylethyl)phenyl ester
Modify Date: 2025-08-25 13:07:14
Benzenesulfonic acid,2-nitro-, 4-(1,1-dimethylethyl)phenyl ester structure
|
Common Name | Benzenesulfonic acid,2-nitro-, 4-(1,1-dimethylethyl)phenyl ester | ||
|---|---|---|---|---|
| CAS Number | 25282-57-9 | Molecular Weight | 335.37500 | |
| Density | 1.281g/cm3 | Boiling Point | 479.8ºC at 760mmHg | |
| Molecular Formula | C16H17NO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 244ºC | |
| Name | (4-tert-butylphenyl) 2-nitrobenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.281g/cm3 |
|---|---|
| Boiling Point | 479.8ºC at 760mmHg |
| Molecular Formula | C16H17NO5S |
| Molecular Weight | 335.37500 |
| Flash Point | 244ºC |
| Exact Mass | 335.08300 |
| PSA | 97.57000 |
| LogP | 5.26400 |
| Vapour Pressure | 6.67E-09mmHg at 25°C |
| Index of Refraction | 1.575 |
| InChIKey | RQMIQXXWOAKARJ-UHFFFAOYSA-N |
| SMILES | CC(C)(C)c1ccc(OS(=O)(=O)c2ccccc2[N+](=O)[O-])cc1 |
|
~%
Benzenesulfonic... CAS#:25282-57-9 |
| Literature: Dannley,R.L. et al. Journal of Organic Chemistry, 1970 , vol. 35, # 9 p. 3076 - 3079 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| p-tert.Butylphenyl-o-nitrobenzolsulfonat |
| 4-tert-butylphenyl 2-nitrobenzenesulfonate |