Benzenesulfonic acid,2-nitro-, 2-ethylphenyl ester structure
|
Common Name | Benzenesulfonic acid,2-nitro-, 2-ethylphenyl ester | ||
|---|---|---|---|---|
| CAS Number | 25238-21-5 | Molecular Weight | 307.32200 | |
| Density | 1.349g/cm3 | Boiling Point | 479.5ºC at 760mmHg | |
| Molecular Formula | C14H13NO5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 243.8ºC | |
| Name | (2-ethylphenyl) 2-nitrobenzenesulfonate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.349g/cm3 |
|---|---|
| Boiling Point | 479.5ºC at 760mmHg |
| Molecular Formula | C14H13NO5S |
| Molecular Weight | 307.32200 |
| Flash Point | 243.8ºC |
| Exact Mass | 307.05100 |
| PSA | 97.57000 |
| LogP | 4.52890 |
| Vapour Pressure | 6.85E-09mmHg at 25°C |
| Index of Refraction | 1.594 |
| InChIKey | MQKWHCOIRFPCDT-UHFFFAOYSA-N |
| SMILES | CCc1ccccc1OS(=O)(=O)c1ccccc1[N+](=O)[O-] |
|
~%
Benzenesulfonic... CAS#:25238-21-5 |
| Literature: Dannley,R.L. et al. Journal of Organic Chemistry, 1970 , vol. 35, # 9 p. 3076 - 3079 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 2-ethylphenyl 2-nitrobenzenesulfonate |
| o-Ethylphenyl-o-nitrobenzolsulfonat |