Amyloid β/A4 Protein Precursor770 (667-676) trifluoroacetate salt
Modify Date: 2025-08-24 23:45:31
Amyloid β/A4 Protein Precursor770 (667-676) trifluoroacetate salt structure
|
Common Name | Amyloid β/A4 Protein Precursor770 (667-676) trifluoroacetate salt | ||
|---|---|---|---|---|
| CAS Number | 252256-37-4 | Molecular Weight | 1211.345 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C51H82N14O18S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | sevkmdaefr |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Molecular Formula | C51H82N14O18S |
| Molecular Weight | 1211.345 |
| Exact Mass | 1210.565186 |
| PSA | 570.57000 |
| LogP | -2.08 |
| Appearance of Characters | solid |
| Index of Refraction | 1.644 |
| InChIKey | BLKDQJZDKNYVBO-MWHZAZASSA-N |
| SMILES | CSCCC(NC(=O)C(CCCCN)NC(=O)C(NC(=O)C(CCC(=O)O)NC(=O)C(N)CO)C(C)C)C(=O)NC(CC(=O)O)C(=O)NC(C)C(=O)NC(CCC(=O)O)C(=O)NC(Cc1ccccc1)C(=O)NC(CCCN=C(N)N)C(=O)O |
| Storage condition | −20°C |
| Safety Phrases | S22;S24/25 |
|---|---|
| WGK Germany | 3 |
| L-Seryl-L-α-glutamyl-L-valyl-L-lysyl-L-methionyl-L-α-aspartyl-L-alanyl-L-α-glutamyl-L-phenylalanyl-N-(diaminomethylene)-L-ornithine |
| L-Ornithine, L-seryl-L-α-glutamyl-L-valyl-L-lysyl-L-methionyl-L-α-aspartyl-L-alanyl-L-α-glutamyl-L-phenylalanyl-N-(diaminomethylene)- |
| amyloid beta/a4 protein precursor770 (667-676) |
| MFCD02684500 |