BSJ-4-116
Modify Date: 2025-08-25 03:49:49
BSJ-4-116 structure
|
Common Name | BSJ-4-116 | ||
|---|---|---|---|---|
| CAS Number | 2519823-34-6 | Molecular Weight | 837.38 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C40H49ClN8O8S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of BSJ-4-116BSJ-4-116 is a specific degrader of cyclin-dependent kinase 12 (CDK12). BSJ-4-116 exhibits potent antiproliferative effects. |
| Name | BSJ-4-116 |
|---|
| Description | BSJ-4-116 is a specific degrader of cyclin-dependent kinase 12 (CDK12). BSJ-4-116 exhibits potent antiproliferative effects. |
|---|
| Molecular Formula | C40H49ClN8O8S |
|---|---|
| Molecular Weight | 837.38 |
| InChIKey | YJOJMGTVKMABKQ-FIQOPJFZSA-N |
| SMILES | CC(C)S(=O)(=O)c1ccccc1Nc1nc(NC2CCCN(CCCCCCCNC(=O)COc3cccc4c3C(=O)N(C3CCC(=O)NC3=O)C4=O)C2)ncc1Cl |
| Hazard Codes | Xi |
|---|