H-Trp(5-Br)-OH structure
|
Common Name | H-Trp(5-Br)-OH | ||
|---|---|---|---|---|
| CAS Number | 25197-99-3 | Molecular Weight | 283.121 | |
| Density | 1.7±0.1 g/cm3 | Boiling Point | 495.8±45.0 °C at 760 mmHg | |
| Molecular Formula | C11H11BrN2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 253.7±28.7 °C | |
Use of H-Trp(5-Br)-OH5-Bromo-L-tryptophan is an α-amino acid derivative that can be found in Semenospongia sp.[1]. |
| Name | 5-bromo-DL-tryptophan |
|---|---|
| Synonym | More Synonyms |
| Description | 5-Bromo-L-tryptophan is an α-amino acid derivative that can be found in Semenospongia sp.[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.7±0.1 g/cm3 |
|---|---|
| Boiling Point | 495.8±45.0 °C at 760 mmHg |
| Molecular Formula | C11H11BrN2O2 |
| Molecular Weight | 283.121 |
| Flash Point | 253.7±28.7 °C |
| Exact Mass | 282.000397 |
| PSA | 71.94000 |
| LogP | 1.89 |
| Vapour Pressure | 0.0±1.3 mmHg at 25°C |
| Index of Refraction | 1.718 |
| InChIKey | KZDNJQUJBMDHJW-VIFPVBQESA-N |
| SMILES | NC(Cc1c[nH]c2ccc(Br)cc12)C(=O)O |
| D,L-5-bromotryptophan |
| 5-bromo-L-tryptophane |
| 5-Bromo-L-tryptophan |
| Tryptophan, 5-bromo- |
| 5-bromotryptophan |
| DL-5-Bromotryptophane |
| (2S)-2-amino-3-(5-bromo-1H-indol-3-yl)propanoic acid |
| L-5-bromotryptophan |