2'-O-MOE-A(Bz)-3'-phosphoramidite
Modify Date: 2025-08-24 15:45:45
2'-O-MOE-A(Bz)-3'-phosphoramidite structure
|
Common Name | 2'-O-MOE-A(Bz)-3'-phosphoramidite | ||
|---|---|---|---|---|
| CAS Number | 251647-53-7 | Molecular Weight | 917.98 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C49H56N7O9P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 2'-O-MOE-A(Bz)-3'-phosphoramiditeDMT-2'-O-MOE-rA(Bz) phosphoramidite is an adenosine analog. Adenosine analogs mostly act as smooth muscle vasodilators and have also been shown to inhibit cancer progression. Its popular products are adenosine phosphate, Acadesine (HY-13417), Clofarabine (HY-A0005), Fludarabine phosphate (HY-B0028) and Vidarabine (HY-B0277)[1]. |
| Name | 2'-O-MOE-A(Bz)-3'-phosphoramidite |
|---|---|
| Synonym | More Synonyms |
| Description | DMT-2'-O-MOE-rA(Bz) phosphoramidite is an adenosine analog. Adenosine analogs mostly act as smooth muscle vasodilators and have also been shown to inhibit cancer progression. Its popular products are adenosine phosphate, Acadesine (HY-13417), Clofarabine (HY-A0005), Fludarabine phosphate (HY-B0028) and Vidarabine (HY-B0277)[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C49H56N7O9P |
|---|---|
| Molecular Weight | 917.98 |
| Exact Mass | 931.403381 |
| LogP | 10.19 |
| InChIKey | VPBYBQBHLYRLHG-UHFFFAOYSA-N |
| SMILES | COCCOC1C(OP(OCCC#N)N(C(C)C)C(C)C)C(COC(c2ccccc2)(c2ccc(OC)cc2)c2ccc(OC)cc2)OC1n1cnc2c(NC(=O)c3ccccc3)ncnc21 |
| Storage condition | 2-8℃ |
| N-Benzoyl-5'-O-[bis(4-methoxyphenyl)(phenyl)methyl]-3'-O-[(2-cyanoethoxy)(diisopropylamino)phosphino]-2'-O-(2-methoxyethyl)adenosine |
| Adenosine, N-benzoyl-5'-O-[bis(4-methoxyphenyl)phenylmethyl]-3'-O-[[bis(1-methylethyl)amino](2-cyanoethoxy)phosphino]-2'-O-(2-methoxyethyl)- |