5'-O-DMT-2'-O-MOE-N6-Bz-rA
Modify Date: 2025-08-25 16:01:31
5'-O-DMT-2'-O-MOE-N6-Bz-rA structure
|
Common Name | 5'-O-DMT-2'-O-MOE-N6-Bz-rA | ||
|---|---|---|---|---|
| CAS Number | 251647-48-0 | Molecular Weight | 731.79 | |
| Density | 1.31 | Boiling Point | N/A | |
| Molecular Formula | C41H41N5O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 5'-O-DMT-2'-O-MOE-N6-Bz-rAN-Benzoyl-5'-O-dmtr-2'-O-(2-methoxyethyl)-adenosine is an adenosine analog. Adenosine analogs mostly act as smooth muscle vasodilators and have also been shown to inhibit cancer progression. Its popular products are adenosine phosphate, Acadesine (HY-13417), Clofarabine (HY-A0005), Fludarabine phosphate (HY-B0028) and Vidarabine (HY-B0277)[1]. |
| Name | N-[9-[(2R,3R,4R,5R)-5-[[bis(4-methoxyphenyl)-phenylmethoxy]methyl]-4-hydroxy-3-(2-methoxyethoxy)oxolan-2-yl]purin-6-yl]benzamide |
|---|---|
| Synonym | More Synonyms |
| Description | N-Benzoyl-5'-O-dmtr-2'-O-(2-methoxyethyl)-adenosine is an adenosine analog. Adenosine analogs mostly act as smooth muscle vasodilators and have also been shown to inhibit cancer progression. Its popular products are adenosine phosphate, Acadesine (HY-13417), Clofarabine (HY-A0005), Fludarabine phosphate (HY-B0028) and Vidarabine (HY-B0277)[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.31 |
|---|---|
| Molecular Formula | C41H41N5O8 |
| Molecular Weight | 731.79 |
| Exact Mass | 731.29600 |
| PSA | 151.80000 |
| LogP | 5.77840 |
| InChIKey | KEVMXGNDTKPSMC-MUMPVVMASA-N |
| SMILES | COCCOC1C(O)C(COC(c2ccccc2)(c2ccc(OC)cc2)c2ccc(OC)cc2)OC1n1cnc2c(NC(=O)c3ccccc3)ncnc21 |
| Storage condition | 2-8°C |
| N-Benzoyl-5'-O-DMTr-2'-O-(2-methoxyethyl)adenosine |
| 5'-O-DMT-2'-O-MOE-N6-Bz-rA |