Poly(Methyl vinyl ether-alt-Maleic acid Monobutyl ester) solution
Modify Date: 2025-08-27 20:18:22
Poly(Methyl vinyl ether-alt-Maleic acid Monobutyl ester) solution structure
|
Common Name | Poly(Methyl vinyl ether-alt-Maleic acid Monobutyl ester) solution | ||
|---|---|---|---|---|
| CAS Number | 25119-68-0 | Molecular Weight | 230.258 | |
| Density | 0.977 g/mL at 25 °C | Boiling Point | N/A | |
| Molecular Formula | C11H18O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 48 °F | |
| Name | Poly(methyl vinyl ether-alt-maleic acid monobutyl ester) solution |
|---|---|
| Synonym | More Synonyms |
| Density | 0.977 g/mL at 25 °C |
|---|---|
| Molecular Formula | C11H18O5 |
| Molecular Weight | 230.258 |
| Flash Point | 48 °F |
| Exact Mass | 230.115417 |
| Index of Refraction | n20/D 1.419 |
| InChIKey | VVMKVFQYONGBPV-MKWAYWHRSA-N |
| SMILES | C=COC.CCCCOC(=O)C=CC(=O)O |
| Storage condition | 2-8°C |
| Hazard Codes | F;Xn |
|---|---|
| Risk Phrases | R11;R20/21/22 |
| Safety Phrases | S16;S26;S36 |
| RIDADR | UN 1866 3/PG 2 |
| WGK Germany | 3 |
| RTECS | EM6515000 |
| MFCD00197915 |
| (2Z)-4-Butoxy-4-oxo-2-butenoic acid - methoxyethene (1:1) |
| (2Z)-2-Butenedioicacid 1-Butyl Ester Polymer With Methoxyethene |
| Butyl Ester of PVM/MA Copolymer |