4-Bromo-2-nitro-1-(trifluoromethyl)benzene structure
|
Common Name | 4-Bromo-2-nitro-1-(trifluoromethyl)benzene | ||
|---|---|---|---|---|
| CAS Number | 251115-21-6 | Molecular Weight | 270.003 | |
| Density | 1.8±0.1 g/cm3 | Boiling Point | 268.9±40.0 °C at 760 mmHg | |
| Molecular Formula | C7H3BrF3NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 116.4±27.3 °C | |
| Name | 4-bromo-2-nitro-1-(trifluoromethyl)benzene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 268.9±40.0 °C at 760 mmHg |
| Molecular Formula | C7H3BrF3NO2 |
| Molecular Weight | 270.003 |
| Flash Point | 116.4±27.3 °C |
| Exact Mass | 268.929932 |
| PSA | 45.82000 |
| LogP | 2.91 |
| Vapour Pressure | 0.0±0.5 mmHg at 25°C |
| Index of Refraction | 1.514 |
| InChIKey | WPDWGHAFCXNYDI-UHFFFAOYSA-N |
| SMILES | O=[N+]([O-])c1cc(Br)ccc1C(F)(F)F |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2904909090 |
|
~85%
4-Bromo-2-nitro... CAS#:251115-21-6 |
| Literature: Parrish, Cynthia A.; Dhanak, Dashyant Patent: US2007/142460 A1, 2007 ; Location in patent: Page/Page column 18 ; |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2904909090 |
|---|---|
| Summary | HS:2904909090 sulphonated, nitrated or nitrosated derivatives of hydrocarbons, whether or not halogenated VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:5.5% General tariff:30.0% |
| 4-Bromo-2-nitrobenzotrifluoride |
| CL8239 |
| 4-Bromo-2-nitro-1-(trifluoromethyl)benzene |
| PC8938 |
| 4-bromo-2-nitro-1-trifluoromethyl-benzene |
| Benzene, 4-bromo-2-nitro-1-(trifluoromethyl)- |