3,3'-Dibromobenzophenone
Modify Date: 2025-08-25 11:16:46
3,3'-Dibromobenzophenone structure
|
Common Name | 3,3'-Dibromobenzophenone | ||
|---|---|---|---|---|
| CAS Number | 25032-74-0 | Molecular Weight | 340.01000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H8Br2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 3,3'-dibromobenzophenone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H8Br2O |
|---|---|
| Molecular Weight | 340.01000 |
| Exact Mass | 337.89400 |
| PSA | 17.07000 |
| LogP | 4.44260 |
| InChIKey | QBNTVYGGZGPJDZ-UHFFFAOYSA-N |
| SMILES | O=C(c1cccc(Br)c1)c1cccc(Br)c1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2914700090 |
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:51339-30-1| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| bis(3-bromophenyl) ketone |
| Bis-(3-brom-phenyl)-keton |
| 3,3'-Dibrom-benzophenon |
| bis(3-bromophenyl)-methanone |
| 3,3'-dibromo-benzophenone |
| 1,1-di(m-bromophenyl)ketone |