(3-Phenyl-1H-inden-1-ylidene)bis(tricyclohexylphosphine)ruthenium(IV) dichloride tetrahydrofuran adduct
Modify Date: 2025-08-27 19:15:25
(3-Phenyl-1H-inden-1-ylidene)bis(tricyclohexylphosphine)ruthenium(IV) dichloride tetrahydrofuran adduct structure
|
Common Name | (3-Phenyl-1H-inden-1-ylidene)bis(tricyclohexylphosphine)ruthenium(IV) dichloride tetrahydrofuran adduct | ||
|---|---|---|---|---|
| CAS Number | 250220-36-1 | Molecular Weight | 923.073 | |
| Density | N/A | Boiling Point | 383.4ºC at 760 mmHg | |
| Molecular Formula | C51H76Cl2P2Ru | Melting Point | N/A | |
| MSDS | USA | Flash Point | 195.6ºC | |
| Symbol |
GHS07, GHS08 |
Signal Word | Warning | |
| Name | dichloro-(3-phenylinden-1-ylidene)ruthenium,tricyclohexylphosphane |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 383.4ºC at 760 mmHg |
|---|---|
| Molecular Formula | C51H76Cl2P2Ru |
| Molecular Weight | 923.073 |
| Flash Point | 195.6ºC |
| Exact Mass | 922.384338 |
| PSA | 27.18000 |
| LogP | 17.51350 |
| Appearance of Characters | Powder | brown |
| Vapour Pressure | 9.7E-06mmHg at 25°C |
| InChIKey | UZAFZWUWHHFWOK-UHFFFAOYSA-L |
| SMILES | C1CCC(P(C2CCCCC2)C2CCCCC2)CC1.C1CCC(P(C2CCCCC2)C2CCCCC2)CC1.Cl[Ru](Cl)=C1C=C(c2ccccc2)c2ccccc21 |
| Storage condition | 2-8°C |
| Symbol |
GHS07, GHS08 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H351 |
| Precautionary Statements | P281-P305 + P351 + P338 |
| Hazard Codes | F,Xn |
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36/37/39 |
| RIDADR | UN1325 - class 4.1 - PG 2 - Flammable solids, organic, n.o.s., HI: all |
| (SP-5-31)-Dichloro(3-phenyl-1H-inden-1-ylidene)bis(tricyclohexylphosphine)ruthenium |
| Phosphine, tricyclohexyl-, compd. with dichloro(3-phenyl-1H-inden-1-ylidene)ruthenium (2:1) |
| Dichloro(3-phenyl-1H-inden-1-ylidene)ruthenium - tricyclohexylphosphine (1:2) |
| Dichloro(3-phenyl-1H-inden-1-ylidene)bis(tricyclohexylphosphine)ruthenium(II) |
| MFCD07369034 |
| (3-Phenyl-1H-inden-1-ylidene)bis(tricyclohexylphosphine)ruthenium(IV) Dichloride |