Hexanedioic acid, polymer with 1,3-butanediol
Modify Date: 2025-08-21 16:41:16
Hexanedioic acid, polymer with 1,3-butanediol structure
|
Common Name | Hexanedioic acid, polymer with 1,3-butanediol | ||
|---|---|---|---|---|
| CAS Number | 24937-93-7 | Molecular Weight | 236.26200 | |
| Density | N/A | Boiling Point | 338.5ºC at 760mmHg | |
| Molecular Formula | C10H20O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 172.7ºC | |
| Name | Hexanedioic acid-1,3-butanediol (1:1) |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 338.5ºC at 760mmHg |
|---|---|
| Molecular Formula | C10H20O6 |
| Molecular Weight | 236.26200 |
| Flash Point | 172.7ºC |
| Exact Mass | 236.12600 |
| PSA | 115.06000 |
| LogP | 0.46560 |
| InChIKey | KKPMZLPPEXRJOM-UHFFFAOYSA-N |
| SMILES | CC(O)CCO.O=C(O)CCCCC(=O)O |
| Hexanedioic acid, polymer with 1,3-butanediol |