butane-1,3-diol,hexanedioic acid,terephthalic acid
Modify Date: 2025-10-02 18:20:38
butane-1,3-diol,hexanedioic acid,terephthalic acid structure
|
Common Name | butane-1,3-diol,hexanedioic acid,terephthalic acid | ||
|---|---|---|---|---|
| CAS Number | 41222-49-5 | Molecular Weight | 402.39300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H26O10 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | butane-1,3-diol,hexanedioic acid,terephthalic acid |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C18H26O10 |
|---|---|
| Molecular Weight | 402.39300 |
| Exact Mass | 402.15300 |
| PSA | 189.66000 |
| LogP | 1.54860 |
| InChIKey | OWRLBFCUZDCGBO-UHFFFAOYSA-N |
| SMILES | CC(O)CCO.O=C(O)CCCCC(=O)O.O=C(O)c1ccc(C(=O)O)cc1 |
| 1,4-Benzenedicarboxylic acid,polymer with 1,3-butanediol and hexanedioic acid |
| Terephthalic acid,1,3-butylene glycol,adipic acid polymer |