4-hydroxy-3-nitrobenzenesulphonamide
4-hydroxy-3-nitrobenzenesulphonamide structure
|
Common Name | 4-hydroxy-3-nitrobenzenesulphonamide | ||
|---|---|---|---|---|
| CAS Number | 24855-58-1 | Molecular Weight | 218.18700 | |
| Density | 1.695g/cm3 | Boiling Point | 419.7ºC at 760 mmHg | |
| Molecular Formula | C6H6N2O5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 207.6ºC | |
| Name | 4-Hydroxy-3-nitrobenzenesulfonamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.695g/cm3 |
|---|---|
| Boiling Point | 419.7ºC at 760 mmHg |
| Molecular Formula | C6H6N2O5S |
| Molecular Weight | 218.18700 |
| Flash Point | 207.6ºC |
| Exact Mass | 218.00000 |
| PSA | 134.59000 |
| LogP | 2.25210 |
| Vapour Pressure | 1.22E-07mmHg at 25°C |
| Index of Refraction | 1.646 |
| InChIKey | SXSOYEBKXCZKDH-UHFFFAOYSA-N |
| SMILES | NS(=O)(=O)c1ccc(O)c([N+](=O)[O-])c1 |
| HS Code | 2935009090 |
|---|
|
~%
4-hydroxy-3-nit... CAS#:24855-58-1 |
| Literature: Lavrishchev,V.A. et al. J. Gen. Chem. USSR (Engl. Transl.), 1960 , vol. 30, # 9 p. 3064 - 3072,3037 - 3044 |
|
~%
4-hydroxy-3-nit... CAS#:24855-58-1 |
| Literature: Kermack; Spragg; Tebrich Journal of the Chemical Society, 1939 , p. 608 |
|
~%
4-hydroxy-3-nit... CAS#:24855-58-1 |
| Literature: Kermack; Spragg; Tebrich Journal of the Chemical Society, 1939 , p. 608 |
|
~%
4-hydroxy-3-nit... CAS#:24855-58-1 |
| Literature: Kermack; Spragg; Tebrich Journal of the Chemical Society, 1939 , p. 608 |
|
~%
4-hydroxy-3-nit... CAS#:24855-58-1 |
| Literature: Kermack; Spragg; Tebrich Journal of the Chemical Society, 1939 , p. 608 |
| HS Code | 2935009090 |
|---|---|
| Summary | 2935009090 other sulphonamides VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:35.0% |
| 4-Hydroxy-3-nitrobenzolsulfonamid |
| 4-Hydroxy-3-nitro-benzolsulfonylchlorid |
| 4-Hydroxy-3-nitro-benzolsulfonsaeure-amid |
| Benzenesulfonyl chloride,4-hydroxy-3-nitro-(9CI) |
| 2-Nitro-phenol-sulfonsaeure-(4)-chlorid |
| 4-hydroxy-3-nitrobenzene-1-sulfonyl chloride |
| Benzenesulfonylchloride,4-hydroxy-3-nitro |
| 3-Nitro-4-hydroxy-benzolsulfonsaeure-amid |
| 4-hydroxy-3-nitro-benzenesulfonic acid amide |
| 4-hydroxy-3-nitro-benzenesulfonyl Chloride |
| 4-Hydroxy-3-nitrobenzolsulfonsaeurechlorid |