PROTAC CBP/P300 Degrader-1
Modify Date: 2025-08-25 15:30:41
PROTAC CBP/P300 Degrader-1 structure
|
Common Name | PROTAC CBP/P300 Degrader-1 | ||
|---|---|---|---|---|
| CAS Number | 2484739-48-0 | Molecular Weight | 893.98 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C46H53F2N11O6 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of PROTAC CBP/P300 Degrader-1PROTAC CBP/P300 Degrader-1 is a potent PROTAC CBP/P300 degrader. PROTAC CBP/P300 Degrader-1 potently inhibited cell viability of multiple cancer cell lines[1]. |
| Name | PROTAC CBP/P300 Degrader-1 |
|---|
| Description | PROTAC CBP/P300 Degrader-1 is a potent PROTAC CBP/P300 degrader. PROTAC CBP/P300 Degrader-1 potently inhibited cell viability of multiple cancer cell lines[1]. |
|---|---|
| Related Catalog | |
| Target |
Cereblon |
| In Vitro | PROTAC CBP/P300 Degrader-1 shows LNCaP prostate cancer cell viability inhibition (IC50=0.4 nM). PROTAC CBP/P300 Degrader-1 (10 nM) induces degradation of P300 (≥ 80%)[1]. PROTAC CBP/P300 Degrader-1 potently inhibited cell viability of multiple cancel cell lines (IC50s ranging from 0.1-141.4 nM for HEL, NOMO-1, MOLM-13, HL-60, MEG-01, MM.IS, MM.1R, NCL-H929, RPM-8226, AMO-1, WSU-DLCL2, Karpas-422, Pfeiffer, SU-DHL-1, LNCap clone FGC, VCap; 22RV1, NCI-H520, NCI-H703, LK-2, MCE-7, and SK-BR-3 cells)[1]. |
| References |
| Molecular Formula | C46H53F2N11O6 |
|---|---|
| Molecular Weight | 893.98 |
| InChIKey | KOXRGDZBEAJAKE-UHFFFAOYSA-N |
| SMILES | CNC(=O)N1CCc2c(c(N3CCCc4cc(-c5cnn(C)c5)c(C(F)F)cc43)nn2C2CCN(C(=O)CCCCCNc3cccc4c3C(=O)N(C3CCC(=O)NC3=O)C4=O)CC2)C1 |
| Storage condition | -20°C |