Alpha-ketoisocaproic acid-13C2 sodium structure
|
Common Name | Alpha-ketoisocaproic acid-13C2 sodium | ||
|---|---|---|---|---|
| CAS Number | 2483736-09-8 | Molecular Weight | 155.12 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C413C2H10NaO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Alpha-ketoisocaproic acid-13C2 sodiumAlpha-ketoisocaproic acid-13C2 (sodium) is the 13C labeled Alpha-ketoisocaproic acid sodium[1]. |
| Name | Alpha-ketoisocaproic acid-13C2 sodium |
|---|
| Description | Alpha-ketoisocaproic acid-13C2 (sodium) is the 13C labeled Alpha-ketoisocaproic acid sodium[1]. |
|---|---|
| Related Catalog | |
| In Vitro | Stable heavy isotopes of hydrogen, carbon, and other elements have been incorporated into drug molecules, largely as tracers for quantitation during the drug development process. Deuteration has gained attention because of its potential to affect the pharmacokinetic and metabolic profiles of drugs[1]. |
| References |
| Molecular Formula | C413C2H10NaO3 |
|---|---|
| Molecular Weight | 155.12 |
| InChIKey | IXFAZKRLPPMQEO-IGQLHDOCSA-M |
| SMILES | CC(C)CC(=O)C(=O)[O-].[Na+] |