2-(N,N-DIBENZYL)-AMINO-1,3-PROPANEDIOL structure
|
Common Name | 2-(N,N-DIBENZYL)-AMINO-1,3-PROPANEDIOL | ||
|---|---|---|---|---|
| CAS Number | 246232-73-5 | Molecular Weight | 271.35400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C17H21NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(dibenzylamino)propane-1,3-diol |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C17H21NO2 |
|---|---|
| Molecular Weight | 271.35400 |
| Exact Mass | 271.15700 |
| PSA | 43.70000 |
| LogP | 2.04200 |
| InChIKey | GFYRDQXZVIHUKQ-UHFFFAOYSA-N |
| SMILES | OCC(CO)N(Cc1ccccc1)Cc1ccccc1 |
| Storage condition | 2-8°C |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2922199090 |
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 2-(N,N-Dibenzyl)amino-1,3-propanediol |
| 2-(N,N-di-benzylamino)-1,3-propanediol |
| 2-dibenzylamino-propane-1,3-diol |
| 2-(Dibenzylamino)propane-1,3-diol |