2-[[4-[(2-cyanoethyl)(2-phenylethyl)amino]phenyl]azo]-5-nitrobenzonitrile structure
|
Common Name | 2-[[4-[(2-cyanoethyl)(2-phenylethyl)amino]phenyl]azo]-5-nitrobenzonitrile | ||
|---|---|---|---|---|
| CAS Number | 24610-00-2 | Molecular Weight | 424.45500 | |
| Density | 1.2g/cm3 | Boiling Point | 687.2ºC at 760mmHg | |
| Molecular Formula | C24H20N6O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 369.4ºC | |
Use of 2-[[4-[(2-cyanoethyl)(2-phenylethyl)amino]phenyl]azo]-5-nitrobenzonitrile2-4-(2-Cyanoethyl)(2-phenylethyl)aminophenylazo-5-nitrobenzonitrile is a storage-stable, fluid, nonagglomerating dispersions of azo dye[1]. |
| Name | 2-[[4-[2-cyanoethyl(2-phenylethyl)amino]phenyl]diazenyl]-5-nitrobenzonitrile |
|---|---|
| Synonym | More Synonyms |
| Description | 2-4-(2-Cyanoethyl)(2-phenylethyl)aminophenylazo-5-nitrobenzonitrile is a storage-stable, fluid, nonagglomerating dispersions of azo dye[1]. |
|---|---|
| Related Catalog | |
| References |
[1]. Helmut Hett, et al. Formierter, wasserunloeslicher azofarbstoff und seine herstellung. DE2363376A1. |
| Density | 1.2g/cm3 |
|---|---|
| Boiling Point | 687.2ºC at 760mmHg |
| Molecular Formula | C24H20N6O2 |
| Molecular Weight | 424.45500 |
| Flash Point | 369.4ºC |
| Exact Mass | 424.16500 |
| PSA | 121.36000 |
| LogP | 6.36786 |
| Vapour Pressure | 9.76E-19mmHg at 25°C |
| Index of Refraction | 1.628 |
| InChIKey | CWNHPGPSJLVQCK-UHFFFAOYSA-N |
| SMILES | N#CCCN(CCc1ccccc1)c1ccc(N=Nc2ccc([N+](=O)[O-])cc2C#N)cc1 |
| HS Code | 2927000090 |
|---|
| HS Code | 2927000090 |
|---|---|
| Summary | 2927000090 other diazo-, azo- or azoxy-compounds。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 2-((4-((2-Cyanoethyl)(2-phenylethyl)amino)phenyl)azo)-5-nitrobenzonitrile |
| Benzonitrile,2-((4-((2-cyanoethyl)(2-phenylethyl)amino)phenyl)azo)-5-nitro |
| EINECS 246-352-0 |
| 2-[(E)-{4-[(2-cyanoethyl)(2-phenylethyl)amino]phenyl}diazenyl]-5-nitrobenzonitrile |
| 2-((p-((2-Cyanoethyl)phenethylamino)phenyl)azo)-5-nitrobenzonitrile |
| 2-[[4-[2-cyanoethyl(phenethyl)amino]phenyl]diazenyl]-5-nitrobenzonitrile |