2,5-Di-tert-butyl-1,4-benzoquinone structure
|
Common Name | 2,5-Di-tert-butyl-1,4-benzoquinone | ||
|---|---|---|---|---|
| CAS Number | 2460-77-7 | Molecular Weight | 220.30700 | |
| Density | 1.027g/cm3 | Boiling Point | 285.4ºC at 760 mmHg | |
| Molecular Formula | C14H20O2 | Melting Point | 152-154 °C(lit.) | |
| MSDS | Chinese USA | Flash Point | 106.2ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | 2,5-ditert-butylcyclohexa-2,5-diene-1,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.027g/cm3 |
|---|---|
| Boiling Point | 285.4ºC at 760 mmHg |
| Melting Point | 152-154 °C(lit.) |
| Molecular Formula | C14H20O2 |
| Molecular Weight | 220.30700 |
| Flash Point | 106.2ºC |
| Exact Mass | 220.14600 |
| PSA | 34.14000 |
| LogP | 3.08320 |
| Vapour Pressure | 0.00281mmHg at 25°C |
| Index of Refraction | 1.504 |
| InChIKey | ZZYASVWWDLJXIM-UHFFFAOYSA-N |
| SMILES | CC(C)(C)C1=CC(=O)C(C(C)(C)C)=CC1=O |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATAMUTATION DATA
|
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H315-H319-H335 |
| Precautionary Statements | P261-P305 + P351 + P338 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xi:Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| RTECS | GU5140000 |
| HS Code | 2914690090 |
| Precursor 9 | |
|---|---|
| DownStream 8 | |
| HS Code | 2914690090 |
|---|---|
| Summary | 2914690090 other quinones。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:5.5%。General tariff:30.0% |
|
P2u purinoceptor modulation of intracellular Ca2+ in a human lung adenocarcinoma cell line: down-regulation of Ca2+ influx by protein kinase C.
Cell Calcium 20(4) , 339-46, (1996) The human lung small cell adenocarcinoma cell line, A549, demonstrates a concentration-dependent rise in [Ca2+]i in response to extracellular nucleotides. The cells show Ca2+ mobilization on addition ... |
|
|
The importance of the hydroxyl moieties for inhibition of the Ca(2+)-ATPase by trilobolide and 2,5-di(tert-butyl)-1,4-benzohydroquinone.
Biochem. Biophys. Res. Commun. 199(2) , 916-21, (1994) Trilobolide and 2,5-di(tert-butyl)-1,4-benzohydroquinone (BHQ) are potent inhibitors of the Ca(2+)-ATPase of skeletal muscle sarcoplasmic reticulum. Desoxytrilobolide and 2,5-di(tert-butyl)-1,4-diacet... |
|
|
Redox proteins as electron acceptors from chlorophyll triplet state in lipid bilayer vesicles: kinetics of reduction of membrane reconstituted cytochrome c oxidase mediated by 2,5-di-t-butyl benzoquinone and cytochrome c.
Photochem. Photobiol. 52(4) , 883-91, (1990) Laser flash photolysis was used to determine the kinetics of electron transfer between membrane-bound triplet chlorophyll (3C), cytochrome c (cyt c) located in the external water phase, and vesicle-re... |
| 2,5-Di-tert-butyl-p-benzoquinone |
| MFCD00019442 |
| 2,5-Di-tert-butyl-1,4-benzoquinone |
| 2,5-Di-tert-butyl-2,5-cyclohexadiene-1,4-dione |
| 2,5-di-tert-Butyl-p-quinone |
| 2,5-Di-tert-butylbenzoquinone |
| 2,5-Di-tert-butylquinone |
| 2,5-Di-tert-butylsemiquinone |
| 2,4-DICHLORO-6-FORMYLPHENYL 4-METHYLBENZENESULPHONATE |
| 2,5-di-tert-butyl-para-benzoquinone |
| 2,5-di(tert-butyl)-1,4-hydroquinone |
| EINECS 219-552-0 |