[(1,2-Dimethylethylene)dinitrilo]tetraacetic acid structure
|
Common Name | [(1,2-Dimethylethylene)dinitrilo]tetraacetic acid | ||
|---|---|---|---|---|
| CAS Number | 2458-58-4 | Molecular Weight | 320.29600 | |
| Density | 1.453g/cm3 | Boiling Point | 598.8ºC at 760 mmHg | |
| Molecular Formula | C12H20N2O8 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 315.9ºC | |
| Name | 2-[3-[bis(carboxymethyl)amino]butan-2-yl-(carboxymethyl)amino]acetic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.453g/cm3 |
|---|---|
| Boiling Point | 598.8ºC at 760 mmHg |
| Molecular Formula | C12H20N2O8 |
| Molecular Weight | 320.29600 |
| Flash Point | 315.9ºC |
| Exact Mass | 320.12200 |
| PSA | 155.68000 |
| Vapour Pressure | 6.96E-16mmHg at 25°C |
| Index of Refraction | 1.56 |
| InChIKey | VTZUAJRPOHNJEY-UHFFFAOYSA-N |
| SMILES | CC(C(C)N(CC(=O)O)CC(=O)O)N(CC(=O)O)CC(=O)O |
| HS Code | 2922499990 |
|---|
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| Dimadta |
| Kyselina mezo-2,3-diaminobutan-N,N,N',N'-tetraoctova |
| rac-2,3-Bis-<Dimedta |
| 2,3-butanediaminetetraacetic acid |
| Racemicka Kyselina 2,3-diaminobutan-N,N,N',N'-tetraoctova |
| 2,2',2'',2'''-(butane-2,3-diyldinitrilo)tetraacetic acid |
| 2,3-Diaminobutanetetraacetic acid |
| ACETIC ACID,((1,2-DIMETHYLETHYLENE)DINITRILO)TETRA |
| meso-2,3-Bis-<bis-(carboxymethyl)-amino>-butan |
| rac-Kyselina 2,3-diaminobutan-N,N,N',N'-tetraoctova |
| Dimethylethylenediamine tetra-acetic acid |