1,2-Cyclohexylenedinitrilotetraacetic acid structure
|
Common Name | 1,2-Cyclohexylenedinitrilotetraacetic acid | ||
|---|---|---|---|---|
| CAS Number | 482-54-2 | Molecular Weight | 364.34800 | |
| Density | 1.48g/cm3 | Boiling Point | 375.4ºC at 760 mmHg | |
| Molecular Formula | C14H24N2O9 | Melting Point | 210-220°C | |
| MSDS | N/A | Flash Point | N/A | |
Use of 1,2-Cyclohexylenedinitrilotetraacetic acid1,2-Cyclohexylenedinitrilotetraacetic acid (CDTA) is a chelating agent. 1,2-Cyclohexylenedinitrilotetraacetic acid has an ability to remove manganese from brain and liver (in vivo) and their sub-cellular fractions (in vitro), of rats pretreated with manganese sulphate[1]. |
| Name | cdta |
|---|---|
| Synonym | More Synonyms |
| Description | 1,2-Cyclohexylenedinitrilotetraacetic acid (CDTA) is a chelating agent. 1,2-Cyclohexylenedinitrilotetraacetic acid has an ability to remove manganese from brain and liver (in vivo) and their sub-cellular fractions (in vitro), of rats pretreated with manganese sulphate[1]. |
|---|---|
| Related Catalog | |
| References |
| Density | 1.48g/cm3 |
|---|---|
| Boiling Point | 375.4ºC at 760 mmHg |
| Melting Point | 210-220°C |
| Molecular Formula | C14H24N2O9 |
| Molecular Weight | 364.34800 |
| Exact Mass | 364.14800 |
| PSA | 164.91000 |
| Vapour Pressure | 1.9E-18mmHg at 25°C |
| InChIKey | FCKYPQBAHLOOJQ-UHFFFAOYSA-N |
| SMILES | O=C(O)CN(CC(=O)O)C1CCCCC1N(CC(=O)O)CC(=O)O |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Hazard Codes | Xi |
|---|---|
| HS Code | 2922499990 |
|
~%
1,2-Cyclohexyle... CAS#:482-54-2 |
| Literature: Ward, Irl E.; French, Danielle Patent: US2005/131250 A1, 2005 ; Location in patent: Page/Page column 3 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922499990 |
|---|---|
| Summary | HS:2922499990 other amino-acids, other than those containing more than one kind of oxygen function, and their esters; salts thereof VAT:17.0% Tax rebate rate:9.0% Supervision conditions:AB(certificate of inspection for goods inward,certificate of inspection for goods outward) MFN tariff:6.5% General tariff:30.0% |
| 1,2-diaminocyclohexane-N,N,N',N'-tetraacetic acid hydrate |
| idranal iv |
| EINECS 207-582-7 |
| complexoniv |
| chel600 |
| 1,2-diaminocyclohexane N,N,N',N'-tetraacetique acide |
| 1,2-diaminocyclohexane-N,N,N'N'-tetraacetatic acid |
| octa |
| TitriplexIV |
| 1,2-diaminocyclohexane-N,N,N',N'-tetraacetic acid |
| trans-cyclohexane-1,2-diamine-N,N,N',N'-tetra-acetate |
| komplexoniv |
| 1,2-cyclohexanediamine-N,N,N',N'-tetraacetic acid |
| cgta |