Acetamide,2-cyano-N-(2,4,6-trimethylphenyl)- structure
|
Common Name | Acetamide,2-cyano-N-(2,4,6-trimethylphenyl)- | ||
|---|---|---|---|---|
| CAS Number | 24578-56-1 | Molecular Weight | 202.25200 | |
| Density | 1.115g/cm3 | Boiling Point | 368.9ºC at 760mmHg | |
| Molecular Formula | C12H14N2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 176.9ºC | |
| Name | 2-cyano-N-(2,4,6-trimethylphenyl)acetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.115g/cm3 |
|---|---|
| Boiling Point | 368.9ºC at 760mmHg |
| Molecular Formula | C12H14N2O |
| Molecular Weight | 202.25200 |
| Flash Point | 176.9ºC |
| Exact Mass | 202.11100 |
| PSA | 52.89000 |
| LogP | 2.53698 |
| Vapour Pressure | 1.23E-05mmHg at 25°C |
| Index of Refraction | 1.57 |
| InChIKey | WFTLXUGEGQVHGM-UHFFFAOYSA-N |
| SMILES | Cc1cc(C)c(NC(=O)CC#N)c(C)c1 |
| HS Code | 2926909090 |
|---|
|
~%
Acetamide,2-cya... CAS#:24578-56-1 |
| Literature: Bioorganic and Medicinal Chemistry, , vol. 17, # 3 p. 1079 - 1087 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2926909090 |
|---|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 2-cyano-N-mesitylacetamide |
| N1-mesityl-2-cyanoacetamide |
| 2-Cyano-N-(2,4,6-trimethyl-phenyl)-acetamide |