RWJ 52353 (hydrochloride)
Modify Date: 2024-04-08 14:30:00
RWJ 52353 (hydrochloride) structure
|
Common Name | RWJ 52353 (hydrochloride) | ||
|---|---|---|---|---|
| CAS Number | 245744-13-2 | Molecular Weight | 238.73600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H11ClN2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of RWJ 52353 (hydrochloride)RWJ 52353 hydrochloride is an agonist of α2D-adrenergic receptors (α2D-ARs; Kis = 1.5, 254, 621, and 443 nM for α2D-, α2A-, α2B-, and α1-ARs, respectively). |
| Name | 5-(6,7-dihydro-1-benzothiophen-4-yl)-1H-imidazole,hydrochloride |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C11H11ClN2S |
|---|---|
| Molecular Weight | 238.73600 |
| Exact Mass | 238.03300 |
| PSA | 56.92000 |
| LogP | 3.65110 |
| InChIKey | LIHWQUZNTRDJFW-UHFFFAOYSA-N |
| SMILES | C1=C(c2cnc[nH]2)c2ccsc2CC1.Cl |
| 4-(6,7-Dihydrobenzo[b]thien-4-yl)-1H-imidazole Hydrochloride |