4-(4-chloroanilino)chromen-2-one structure
|
Common Name | 4-(4-chloroanilino)chromen-2-one | ||
|---|---|---|---|---|
| CAS Number | 24526-89-4 | Molecular Weight | 271.69800 | |
| Density | 1.415g/cm3 | Boiling Point | 451ºC at 760mmHg | |
| Molecular Formula | C15H10ClNO2 | Melting Point | 299-301ºC | |
| MSDS | N/A | Flash Point | 226.5ºC | |
| Name | 4-(4-chloroanilino)chromen-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.415g/cm3 |
|---|---|
| Boiling Point | 451ºC at 760mmHg |
| Melting Point | 299-301ºC |
| Molecular Formula | C15H10ClNO2 |
| Molecular Weight | 271.69800 |
| Flash Point | 226.5ºC |
| Exact Mass | 271.04000 |
| PSA | 42.24000 |
| LogP | 4.26300 |
| Vapour Pressure | 2.53E-08mmHg at 25°C |
| Index of Refraction | 1.696 |
| InChIKey | XTKKFDIRDFFXEM-UHFFFAOYSA-N |
| SMILES | O=c1cc(Nc2ccc(Cl)cc2)c2ccccc2o1 |
| HS Code | 2932209090 |
|---|
|
~92%
4-(4-chloroanil... CAS#:24526-89-4 |
| Literature: Chavan, Abhijit P. Journal of Chemical Research, 2006 , # 3 p. 179 - 181 |
|
~%
4-(4-chloroanil... CAS#:24526-89-4 |
| Literature: Gazzetta Chimica Italiana, , vol. 99, p. 501 - 513 |
|
~%
4-(4-chloroanil... CAS#:24526-89-4 |
| Literature: Gazzetta Chimica Italiana, , vol. 99, p. 501 - 513 |
| HS Code | 2932209090 |
|---|---|
| Summary | 2932209090. other lactones. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| chloroanilinochromenone |
| 4-(4-chloroanilino)-2H-chromen-2-one |
| 4-(4'-chlorophenylamino)coumarin |