6H-Purine-6-thione,2-amino-1,9-dihydro-9-pentyl- structure
|
Common Name | 6H-Purine-6-thione,2-amino-1,9-dihydro-9-pentyl- | ||
|---|---|---|---|---|
| CAS Number | 24397-98-6 | Molecular Weight | 237.32500 | |
| Density | 1.42g/cm3 | Boiling Point | 480ºC at 760mmHg | |
| Molecular Formula | C10H15N5S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 244.1ºC | |
| Name | 2-amino-9-pentyl-3H-purine-6-thione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.42g/cm3 |
|---|---|
| Boiling Point | 480ºC at 760mmHg |
| Molecular Formula | C10H15N5S |
| Molecular Weight | 237.32500 |
| Flash Point | 244.1ºC |
| Exact Mass | 237.10500 |
| PSA | 104.61000 |
| LogP | 2.84250 |
| Vapour Pressure | 2.25E-09mmHg at 25°C |
| Index of Refraction | 1.721 |
| InChIKey | GKBUGVWFLBNNPA-UHFFFAOYSA-N |
| SMILES | CCCCCn1cnc2c(=S)nc(N)[nH]c21 |
|
~97%
6H-Purine-6-thi... CAS#:24397-98-6 |
| Literature: Hanna; Bhattacharya; Robins; Avery; Revankar Journal of Medicinal Chemistry, 1994 , vol. 37, # 1 p. 177 - 183 |
|
~%
6H-Purine-6-thi... CAS#:24397-98-6 |
| Literature: Hanna; Bhattacharya; Robins; Avery; Revankar Journal of Medicinal Chemistry, 1994 , vol. 37, # 1 p. 177 - 183 |
|
~%
6H-Purine-6-thi... CAS#:24397-98-6 |
| Literature: Hanna; Bhattacharya; Robins; Avery; Revankar Journal of Medicinal Chemistry, 1994 , vol. 37, # 1 p. 177 - 183 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| 2-amino-9-pentyl-1,9-dihydro-purine-6-thione |
| HMS2885H17 |
| 9-Pentyl-2-amino-6-mercapto-9H-purin |