phenacyl morpholine-4-carbodithioate structure
|
Common Name | phenacyl morpholine-4-carbodithioate | ||
|---|---|---|---|---|
| CAS Number | 24372-61-0 | Molecular Weight | 281.39400 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H15NO2S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | phenacyl morpholine-4-carbodithioate |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C13H15NO2S2 |
|---|---|
| Molecular Weight | 281.39400 |
| Exact Mass | 281.05400 |
| PSA | 86.93000 |
| LogP | 2.15750 |
| InChIKey | LOSQNMWWTMNITB-UHFFFAOYSA-N |
| SMILES | O=C(CSC(=S)N1CCOCC1)c1ccccc1 |
|
~94%
phenacyl morpho... CAS#:24372-61-0 |
| Literature: Khalilzadeh, Mohammad A.; Hossaini, Zinatossadat; Baradarani, Mohammad M.; Hasannia, Adel Tetrahedron, 2010 , vol. 66, # 43 p. 8464 - 8467 |
|
~86%
phenacyl morpho... CAS#:24372-61-0 |
| Literature: Bhai, Aziz; Das, A.; Medheker, S.; Boparai, K. S. Journal of the Indian Chemical Society, 1981 , vol. 58, p. 295 - 296 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| Morpholinodithiocarbonsaeure-phenacylester |
| Morpholine-4-carbodithioic acid 2-oxo-2-phenyl-ethyl ester |
| HMS1579G17 |
| 2-oxo-2-phenylethyl morpholine-4-carbodithioate |