barium isopropoxide
Modify Date: 2024-01-11 11:58:05
barium isopropoxide structure
|
Common Name | barium isopropoxide | ||
|---|---|---|---|---|
| CAS Number | 24363-37-9 | Molecular Weight | 255.50100 | |
| Density | 0.89 | Boiling Point | 82ºC | |
| Molecular Formula | C6H14BaO2 | Melting Point | 200ºC (dec.)(lit.) | |
| MSDS | Chinese USA | Flash Point | 11.7ºC | |
| Symbol |
GHS02, GHS07 |
Signal Word | Warning | |
| Name | barium(2+),propan-2-olate |
|---|---|
| Synonym | More Synonyms |
| Density | 0.89 |
|---|---|
| Boiling Point | 82ºC |
| Melting Point | 200ºC (dec.)(lit.) |
| Molecular Formula | C6H14BaO2 |
| Molecular Weight | 255.50100 |
| Flash Point | 11.7ºC |
| Exact Mass | 256.00500 |
| PSA | 18.46000 |
| LogP | 1.75140 |
| Appearance of Characters | powder | Brown to yellow |
| Vapour Pressure | 81.3mmHg at 25°C |
| InChIKey | CPUJSIVIXCTVEI-UHFFFAOYSA-N |
| SMILES | CC(C)[O-].CC(C)[O-].[Ba+2] |
| Water Solubility | Soluble in alcohols, ketones and esters. Reacts with water. |
| Symbol |
GHS02, GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H252-H302-H332 |
| Precautionary Statements | P235 + P410 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn: Harmful; |
| Risk Phrases | 20/22 |
| Safety Phrases | 28 |
| RIDADR | UN 3205 4.2/PG 3 |
| WGK Germany | 1 |
| Packaging Group | III |
| Hazard Class | 4.2 |
|
Turevskaya, E.P. et al.
Polyhedron 14 , 1531, (1995)
|
|
|
Yamada, Y.M.A. Shibasaki, M.
Tetrahedron Lett. 39 , 5561, (1998)
|
| Barium isopropoxide |
| MFCD00050486 |