Benzenamine,4-(2,4-cyclopentadien-1-ylidenemethyl)-N,N-dimethyl- structure
|
Common Name | Benzenamine,4-(2,4-cyclopentadien-1-ylidenemethyl)-N,N-dimethyl- | ||
|---|---|---|---|---|
| CAS Number | 2428-22-0 | Molecular Weight | 197.27600 | |
| Density | 1.089g/cm3 | Boiling Point | 357.5ºC at 760 mmHg | |
| Molecular Formula | C14H15N | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 145.3ºC | |
| Name | 4-(cyclopenta-2,4-dien-1-ylidenemethyl)-N,N-dimethylaniline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.089g/cm3 |
|---|---|
| Boiling Point | 357.5ºC at 760 mmHg |
| Molecular Formula | C14H15N |
| Molecular Weight | 197.27600 |
| Flash Point | 145.3ºC |
| Exact Mass | 197.12000 |
| PSA | 3.24000 |
| LogP | 3.26200 |
| Vapour Pressure | 2.71E-05mmHg at 25°C |
| Index of Refraction | 1.664 |
| InChIKey | FIXQBRDVPNLSGD-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc(C=C2C=CC=C2)cc1 |
| HS Code | 2921420090 |
|---|
|
~98%
Benzenamine,4-(... CAS#:2428-22-0 |
| Literature: Cokun, Necdet; Erden, Ihsan Tetrahedron, 2011 , vol. 67, # 45 p. 8607 - 8614 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2921420090 |
|---|---|
| Summary | HS:2921420090 aniline derivatives and their salts VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| 4-(2,4-Cyclopentadien-1-ylidenemethyl)-N,N-dimethylaniline |
| 6-(p-N,N-dimethylanilinyl)fulvene |
| 6-(4-dimethylaminophenyl)fulvene |
| 4-cyclopentadienylidenemethyl-N,N-dimethyl-aniline |
| 6-(p-dimethylaminophenyl)fulvene |
| 4-(cyclopenta-2,4-dienylidenemethyl)-N,N-dimethylbenzenamine |
| 6-(p-dimethylanilinyl)fulvene |