3-(1-tert-butoxycarbonylpiperazin-4-yl)propionic acid structure
|
Common Name | 3-(1-tert-butoxycarbonylpiperazin-4-yl)propionic acid | ||
|---|---|---|---|---|
| CAS Number | 242459-97-8 | Molecular Weight | 258.314 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 389.1±37.0 °C at 760 mmHg | |
| Molecular Formula | C12H22N2O4 | Melting Point | 138ºC | |
| MSDS | N/A | Flash Point | 189.1±26.5 °C | |
| Name | 3-[4-[(2-methylpropan-2-yl)oxycarbonyl]piperazin-1-yl]propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 389.1±37.0 °C at 760 mmHg |
| Melting Point | 138ºC |
| Molecular Formula | C12H22N2O4 |
| Molecular Weight | 258.314 |
| Flash Point | 189.1±26.5 °C |
| Exact Mass | 258.157959 |
| PSA | 70.08000 |
| LogP | 0.75 |
| Vapour Pressure | 0.0±1.9 mmHg at 25°C |
| Index of Refraction | 1.499 |
| InChIKey | WGQDOZLISKTFIH-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCN(CCC(=O)O)CC1 |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-Piperazinepropanoic acid, 4-[(1,1-dimethylethoxy)carbonyl]- |
| 4-Boc-1-piperazinepropanoic acid |
| 3-[4-(tert-Butoxycarbonyl)piperazin-1-yl]propanoic acid |
| MFCD03410257 |
| 3-(4-{[(2-Methyl-2-propanyl)oxy]carbonyl}-1-piperazinyl)propanoic acid |