1-(5-acetyl-2,6-dimethylpyridin-3-yl)ethanone structure
|
Common Name | 1-(5-acetyl-2,6-dimethylpyridin-3-yl)ethanone | ||
|---|---|---|---|---|
| CAS Number | 24234-61-5 | Molecular Weight | 191.22600 | |
| Density | 1.072g/cm3 | Boiling Point | 349.5ºC at 760 mmHg | |
| Molecular Formula | C11H13NO2 | Melting Point | 71-73ºC(lit.) | |
| MSDS | N/A | Flash Point | 169.2ºC | |
| Name | 1-(5-acetyl-2,6-dimethylpyridin-3-yl)ethanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.072g/cm3 |
|---|---|
| Boiling Point | 349.5ºC at 760 mmHg |
| Melting Point | 71-73ºC(lit.) |
| Molecular Formula | C11H13NO2 |
| Molecular Weight | 191.22600 |
| Flash Point | 169.2ºC |
| Exact Mass | 191.09500 |
| PSA | 47.03000 |
| LogP | 2.10360 |
| Vapour Pressure | 4.69E-05mmHg at 25°C |
| Index of Refraction | 1.518 |
| InChIKey | RCACBGGDSKMOCT-UHFFFAOYSA-N |
| SMILES | CC(=O)c1cc(C(C)=O)c(C)nc1C |
| HS Code | 2933399090 |
|---|---|
| Summary | 2933399090. other compounds containing an unfused pyridine ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| MFCD00191976 |
| 2,6-dimethyl-3,5-diacetylpyridine |
| Ethanone,1,1'-(2,6-dimethyl-3,5-pyridinediyl)bis |
| 3,5-Diacetyllutidin |
| 3,5-diacetyl-2,5-dimethylpyridine |
| 1,1'-(2,6-dimethyl-pyridine-3,5-diyl)-bis-ethanone |
| 3,5.diacetyl-2,6-dimethylpyridine |
| 1,1'-(2,6-dimethylpyridine-3,5-diyl)diethanone |