JKE-1716 structure
|
Common Name | JKE-1716 | ||
|---|---|---|---|---|
| CAS Number | 2421118-05-8 | Molecular Weight | 451.303 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 641.1±65.0 °C at 760 mmHg | |
| Molecular Formula | C20H20Cl2N4O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 341.5±34.3 °C | |
Use of JKE-1716JKE-1716 is a potent and selective nitrolic acid-containing GPX4 inhibitor. JKE-1716 is able of inducing ferroptosis selectively through covalent GPX4 inhibition[1]. |
| Name | JKE-1716 |
|---|---|
| Synonym | More Synonyms |
| Description | JKE-1716 is a potent and selective nitrolic acid-containing GPX4 inhibitor. JKE-1716 is able of inducing ferroptosis selectively through covalent GPX4 inhibition[1]. |
|---|---|
| Related Catalog | |
| Target |
GPX4[1]; Ferroptosis[1] |
| In Vitro | JKE-1716 (0~100 nΜ; 72 hours; LOX-IMVI cells) inhibits cell viability[1]. JKE-1716 (LOX-IMVI cells) inhibits the expression of α-GPX4[1]. Cell Viability Assay[1] Cell Line: LOX-IMVI cells Concentration: 0~100 nΜ Incubation Time: 72 hours Result: Inhibited cell viability. |
| References |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 641.1±65.0 °C at 760 mmHg |
| Molecular Formula | C20H20Cl2N4O4 |
| Molecular Weight | 451.303 |
| Flash Point | 341.5±34.3 °C |
| Exact Mass | 450.086151 |
| LogP | 3.84 |
| Vapour Pressure | 0.0±2.0 mmHg at 25°C |
| Index of Refraction | 1.651 |
| InChIKey | HZFRTZXJNACSIE-NKFKGCMQSA-N |
| SMILES | O=C(CC(=NO)[N+](=O)[O-])N1CCN(C(c2ccc(Cl)cc2)c2ccc(Cl)cc2)CC1 |
| (3Z)-1-{4-[Bis(4-chlorophenyl)methyl]-1-piperazinyl}-3-(hydroxyimino)-3-nitro-1-propanone |
| 1,3-Propanedione, 1-[4-[bis(4-chlorophenyl)methyl]-1-piperazinyl]-3-nitro-, 3-oxime, (3Z)- |
| JKE-1716 |