m-PEG15-acetic acid
Modify Date: 2025-12-04 21:23:45
m-PEG15-acetic acid structure
|
Common Name | m-PEG15-acetic acid | ||
|---|---|---|---|---|
| CAS Number | 2417256-16-5 | Molecular Weight | 750.87 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C33H66O18 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of m-PEG15-acetic acidm-PEG15-acetic acid is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | m-PEG15-acetic acid |
|---|
| Description | m-PEG15-acetic acid is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C33H66O18 |
|---|---|
| Molecular Weight | 750.87 |
| InChIKey | RXTPSHDLOBMKTK-UHFFFAOYSA-N |
| SMILES | COCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCCOCC(=O)O |