9-Chloromethyl-10-hydroxy-11-F-Camptothecin
Modify Date: 2026-06-25 17:17:28
9-Chloromethyl-10-hydroxy-11-F-Camptothecin structure
|
Common Name | 9-Chloromethyl-10-hydroxy-11-F-Camptothecin | ||
|---|---|---|---|---|
| CAS Number | 2414594-22-0 | Molecular Weight | 428.84 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C22H18ClFN2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of 9-Chloromethyl-10-hydroxy-11-F-Camptothecin9-Chloromethyl-10-hydroxy-11-F-Camptothecin is a novel camptothecin derivatives.9-Chloromethyl-10-hydroxy-11-F-Camptothecin is a DNA topoisomerase I (Topo I) inhibitor, can be used in anticancer research[1]. |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 9-Chloromethyl-10-hydroxy-11-F-Camptothecin |
|---|
This table contains bioactivity, target information and biological‑assay experimental data of this compound.
| Description | 9-Chloromethyl-10-hydroxy-11-F-Camptothecin is a novel camptothecin derivatives.9-Chloromethyl-10-hydroxy-11-F-Camptothecin is a DNA topoisomerase I (Topo I) inhibitor, can be used in anticancer research[1]. |
|---|---|
| Related Catalog | |
| References |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C22H18ClFN2O4 |
|---|---|
| Molecular Weight | 428.84 |
| InChIKey | VIMRBMFQCXMCKY-QFIPXVFZSA-N |
| SMILES | CCC1(O)C(=O)OCc2c1cc1n(c2=O)Cc2c-1nc1cc(F)c(C)cc1c2CCl |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the CAS number of 9-Chloromethyl-10-hydroxy-11-F-Camptothecin? |
| A: CAS number of 9-Chloromethyl-10-hydroxy-11-F-Camptothecin is 2414594-22-0. |
| Q: What is the molecular weight of 9-Chloromethyl-10-hydroxy-11-F-Camptothecin? |
| A: Molecular weight of 9-Chloromethyl-10-hydroxy-11-F-Camptothecin is 428.84. |
| Q: What is the SMILES notation of 9-Chloromethyl-10-hydroxy-11-F-Camptothecin? |
| A: SMILES notation of 9-Chloromethyl-10-hydroxy-11-F-Camptothecin is CCC1(O)C(=O)OCc2c1cc1n(c2=O)Cc2c-1nc1cc(F)c(C)cc1c2CCl. |
| Q: What are the uses of 9-Chloromethyl-10-hydroxy-11-F-Camptothecin? |
| A: Main uses of 9-Chloromethyl-10-hydroxy-11-F-Camptothecin: 9-Chloromethyl-10-hydroxy-11-F-Camptothecin is a novel camptothecin derivatives.9-Chloromethyl-10-hydroxy-11-F-Camptothecin is a DNA topoisomerase I (Topo I) inhibitor, can be used in anticancer research[1]. |
| Q: What is the molecular formula of 9-Chloromethyl-10-hydroxy-11-F-Camptothecin? |
| A: Molecular formula of 9-Chloromethyl-10-hydroxy-11-F-Camptothecin is C22H18ClFN2O4. |
| Q: What is the Chinese name of 2414594-22-0? |
| A: Chinese name of 2414594-22-0 is 2414594-22-0. |
| Q: What is the InChIKey of 9-Chloromethyl-10-hydroxy-11-F-Camptothecin? |
| A: InChIKey of 9-Chloromethyl-10-hydroxy-11-F-Camptothecin is VIMRBMFQCXMCKY-QFIPXVFZSA-N. |
| Q: What is the English name of 9-Chloromethyl-10-hydroxy-11-F-Camptothecin? |
| A: The English name of 9-Chloromethyl-10-hydroxy-11-F-Camptothecin is 9-Chloromethyl-10-hydroxy-11-F-Camptothecin. |