Evifacotrep
Modify Date: 2025-08-23 14:46:26
Evifacotrep structure
|
Common Name | Evifacotrep | ||
|---|---|---|---|---|
| CAS Number | 2413739-88-3 | Molecular Weight | 441.77 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C18H12ClF4N5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of EvifacotrepEvifacotrep, a short transient receptor potential channel 5 (TRPC5) antagonist (WO2020061162, compound 100), can be used for the research of neurological diseases[1]. |
| Name | Evifacotrep |
|---|
| Description | Evifacotrep, a short transient receptor potential channel 5 (TRPC5) antagonist (WO2020061162, compound 100), can be used for the research of neurological diseases[1]. |
|---|---|
| Related Catalog | |
| Target |
TRPC5[1] |
| In Vitro | Evifacotrep is a short transient receptor potential channel 5 (TRPC5) antagonist[1]. |
| References |
[1]. WO2020061162 |
| Molecular Formula | C18H12ClF4N5O2 |
|---|---|
| Molecular Weight | 441.77 |
| InChIKey | IQFZADSTVFSHDX-UHFFFAOYSA-N |
| SMILES | O=c1[nH]ncc(N2CCc3c(ncnc3Oc3ccc(F)cc3C(F)(F)F)C2)c1Cl |