3,5,6-Triphenyl-1,2,4-triazine structure
|
Common Name | 3,5,6-Triphenyl-1,2,4-triazine | ||
|---|---|---|---|---|
| CAS Number | 24108-44-9 | Molecular Weight | 309.36400 | |
| Density | 1.167g/cm3 | Boiling Point | 504ºC at 760mmHg | |
| Molecular Formula | C21H15N3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 225.2ºC | |
| Name | 3,5,6-Triphenyl-1,2,4-triazine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.167g/cm3 |
|---|---|
| Boiling Point | 504ºC at 760mmHg |
| Molecular Formula | C21H15N3 |
| Molecular Weight | 309.36400 |
| Flash Point | 225.2ºC |
| Exact Mass | 309.12700 |
| PSA | 38.67000 |
| LogP | 4.87260 |
| Vapour Pressure | 8.65E-10mmHg at 25°C |
| Index of Refraction | 1.63 |
| InChIKey | IMJWQBWRRPZDAZ-UHFFFAOYSA-N |
| SMILES | c1ccc(-c2nnc(-c3ccccc3)c(-c3ccccc3)n2)cc1 |
| HS Code | 2933699090 |
|---|
| Precursor 9 | |
|---|---|
| DownStream 6 | |
| HS Code | 2933699090 |
|---|---|
| Summary | 2933699090 other compounds containing an unfused triazine ring (whether or not hydrogenated) in the structure。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:20.0% |
| 1,2,4-Triazine,3,5,6-triphenyl |
| 3,5,6-Triphenyl-as-triazin |
| 3,5,6-triphenyl-[1,2,4]triazine |
| Triphenyl-[1,2,4]triazin |
| as-Triazine,3,5,6-triphenyl-(6CI,7CI,8CI) |
| 2,4,5-Triphenyl-pyrimidin |
| 3,5,6-Triphenyl-1,2,4-triazin |
| 3,5,6-Triphenyl-as-triazine |