1H-Pyrazole,3,4,5-triphenyl- structure
|
Common Name | 1H-Pyrazole,3,4,5-triphenyl- | ||
|---|---|---|---|---|
| CAS Number | 18076-30-7 | Molecular Weight | 296.36500 | |
| Density | 1.153g/cm3 | Boiling Point | 445.8ºC at 760mmHg | |
| Molecular Formula | C21H16N2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 194.2ºC | |
| Name | 3,4,5-triphenyl-1H-pyrazole |
|---|---|
| Synonym | More Synonyms |
| Density | 1.153g/cm3 |
|---|---|
| Boiling Point | 445.8ºC at 760mmHg |
| Molecular Formula | C21H16N2 |
| Molecular Weight | 296.36500 |
| Flash Point | 194.2ºC |
| Exact Mass | 296.13100 |
| PSA | 28.68000 |
| LogP | 5.41070 |
| Vapour Pressure | 1.01E-07mmHg at 25°C |
| Index of Refraction | 1.64 |
| InChIKey | NAFYHLQTAPLJKI-UHFFFAOYSA-N |
| SMILES | c1ccc(-c2n[nH]c(-c3ccccc3)c2-c2ccccc2)cc1 |
| HS Code | 2933199090 |
|---|
| HS Code | 2933199090 |
|---|---|
| Summary | 2933199090. other compounds containing an unfused pyrazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 3,4,5-Triphenylpyrazole |
| 3,4,5-trihenylpyrazole |
| 1H-Pyrazole,3,4,5-triphenyl |
| 3,4,5-Triphenyl-1H-pyrazol |
| 3,4,5-Triphenyl-pyrazol |