5-Chloroisatonic anhydride structure
|
Common Name | 5-Chloroisatonic anhydride | ||
|---|---|---|---|---|
| CAS Number | 24088-81-1 | Molecular Weight | 197.575 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C8H4ClNO3 | Melting Point | 300ºC | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 6-chloroisatin |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Melting Point | 300ºC |
| Molecular Formula | C8H4ClNO3 |
| Molecular Weight | 197.575 |
| Exact Mass | 196.987976 |
| PSA | 63.07000 |
| LogP | 1.50 |
| Index of Refraction | 1.601 |
| InChIKey | QYCPYRXDUHFORA-UHFFFAOYSA-N |
| SMILES | O=c1[nH]c(=O)c2cc(Cl)ccc2o1 |
| Storage condition | 2-8℃ |
| Hazard Codes | Xi:Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S37/39 |
| HS Code | 2934999090 |
|
~91%
5-Chloroisatoni... CAS#:24088-81-1 |
| Literature: NOVARTIS AG; NOVARTIS PHARMA GMBH Patent: WO2006/63821 A1, 2006 ; Location in patent: Page/Page column 33-34 ; |
|
~11%
5-Chloroisatoni... CAS#:24088-81-1 |
| Literature: Journal of Organic Chemistry, , vol. 53, # 17 p. 4112 - 4114 |
|
~18%
5-Chloroisatoni... CAS#:24088-81-1 |
| Literature: Journal of Organic Chemistry, , vol. 53, # 17 p. 4112 - 4114 |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 6-CHLOROINDOLE-2,3-DIONE |
| 6-Chlor-benz[e][1,3]oxazin-2,4-dion |
| 6-chloro-benzo[e][1,3]oxazine-2,4-dione |
| 2H-1,3-Benzoxazine-2,4(3H)-dione,6-chloro |
| 6-Chloroisatin anhydride |
| BUTTPARK 50 7-92 |
| 2H-3,1-Benzoxazine-2,4(1H)-dione, 6-chloro- |
| 6-chloro-2H-1,3-benzoxazine-2,4(3H)-dione |
| 6-chloro-carsalam |
| 6-Chloro isatinic anhydride |
| 6-chloro-benz[e][1,3]oxazine-2,4-dione |
| 6-Chlor-1,3-benzoxazin-dion-(2,4) |
| 6-Chloro-1H-benzo[d][1,3]oxazine-2,4-dione |
| 6-CHLORO-2,3-INDOLINEDIONE |
| MFCD00086347 |
| 5-Chloroisatonic anhydride |
| 6-Chloro-2H-3,1-benzoxazine-2,4(1H)-dione |