H-Trp-Ala-OH
Modify Date: 2025-08-25 10:13:09
H-Trp-Ala-OH structure
|
Common Name | H-Trp-Ala-OH | ||
|---|---|---|---|---|
| CAS Number | 24046-71-7 | Molecular Weight | 275.30300 | |
| Density | 1.338 g/cm3 | Boiling Point | 629.8ºC at 760 mmHg | |
| Molecular Formula | C14H17N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 334.7ºC | |
Use of H-Trp-Ala-OHTryptophylalanine (NSC 97949) is a biologically active peptide. |
| Name | h-trp-ala-oh |
|---|---|
| Synonym | More Synonyms |
| Description | Tryptophylalanine (NSC 97949) is a biologically active peptide. |
|---|---|
| Related Catalog |
| Density | 1.338 g/cm3 |
|---|---|
| Boiling Point | 629.8ºC at 760 mmHg |
| Molecular Formula | C14H17N3O3 |
| Molecular Weight | 275.30300 |
| Flash Point | 334.7ºC |
| Exact Mass | 275.12700 |
| PSA | 108.21000 |
| LogP | 1.71820 |
| Vapour Pressure | 9.98E-17mmHg at 25°C |
| Index of Refraction | 1.652 |
| InChIKey | OHGNSVACHBZKSS-KWQFWETISA-N |
| SMILES | CC(NC(=O)C(N)Cc1c[nH]c2ccccc12)C(=O)O |
| HS Code | 2933990090 |
|---|
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:78440-76-3| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| L-tryptophyl-L-alanine |
| N-L-tryptophyl-L-alanine |
| trp-ala |
| L-Trp-L-Ala-OH |
| L-tryptophanyl-L-alanine |