2,4-Thiazolidinedione,5-[(4-hydroxy-3-methoxyphenyl)methylene]- structure
|
Common Name | 2,4-Thiazolidinedione,5-[(4-hydroxy-3-methoxyphenyl)methylene]- | ||
|---|---|---|---|---|
| CAS Number | 24044-50-6 | Molecular Weight | 251.25800 | |
| Density | 1.5g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H9NO4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-[(4-hydroxy-3-methoxyphenyl)methylidene]-1,3-thiazolidine-2,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5g/cm3 |
|---|---|
| Molecular Formula | C11H9NO4S |
| Molecular Weight | 251.25800 |
| Exact Mass | 251.02500 |
| PSA | 100.93000 |
| LogP | 2.05350 |
| Index of Refraction | 1.701 |
| InChIKey | KAICHBSRWFIESE-UHFFFAOYSA-N |
| SMILES | COc1cc(C=C2SC(=O)NC2=O)ccc1O |
| Storage condition | -20℃ |
|
~92%
2,4-Thiazolidin... CAS#:24044-50-6 |
| Literature: Rathod, Sandip; Navgire, Madhukar; Arbad, Balasaheb; Lande, MacHhindra South African Journal of Chemistry, 2012 , vol. 65, p. 196 - 201 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 4-hydroxy-3-methoxy-3'-nitrobiphenyl |
| 4-hydroxy-3-methoxy-5-benzylidene-2,4-thiazolidinedione |