ethirimol structure
|
Common Name | ethirimol | ||
|---|---|---|---|---|
| CAS Number | 23947-60-6 | Molecular Weight | 209.288 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 365.7±34.0 °C at 760 mmHg | |
| Molecular Formula | C11H19N3O | Melting Point | 159-160ºC | |
| MSDS | Chinese USA | Flash Point | 174.9±25.7 °C | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | ethirimol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 365.7±34.0 °C at 760 mmHg |
| Melting Point | 159-160ºC |
| Molecular Formula | C11H19N3O |
| Molecular Weight | 209.288 |
| Flash Point | 174.9±25.7 °C |
| Exact Mass | 209.152817 |
| PSA | 58.04000 |
| LogP | 2.53 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.560 |
| InChIKey | BBXXLROWFHWFQY-UHFFFAOYSA-N |
| SMILES | CCCCc1c(C)nc(NCC)[nH]c1=O |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
MUTATION DATA
|
|
~%
ethirimol CAS#:23947-60-6 |
| Literature: US3947440 A1, ; |
|
~%
ethirimol CAS#:23947-60-6 |
| Literature: Revue Roumaine de Chimie, , vol. 36, # 4-7 p. 665 - 670 |
| HS Code | 2933599018 |
|---|---|
| Summary | 2933599018 5-butyl-2-(ethylamino)-6-methylpyrimidin-4-yl dimethylsulfamate |
|
Selective solid-phase extraction using molecularly imprinted polymer as a sorbent for the analysis of fenarimol in food samples.
Food Chem. 199 , 870-5, (2016) In the present communication, a non-covalent fenarimol-imprinted polymer was synthesized by precipitation polymerization technique using methacrylic acid (MAA) as a functional monomer, ethylene glycol... |
|
|
[Chromatographic determination of Milgo in water, soil, and plants].
Gig. Sanit. (6) , 69-70, (1980)
|
|
|
Pressurised fluid extraction of bupirimate and ethirimol from aged soils.
J. Chromatogr. A. 918(2) , 429-33, (2001) This paper assesses the effect of pressurised fluid extraction (PFE) on the recovery of bupirimate and its degradation product, ethirimol from a range of soil types. The analytes were extracted under ... |
| New milstem |
| T6VN DMJ CM2 E1 F4 |
| 5-butyl-2-ethylamino-6-methylpyrimidin-4-ol |
| 5-Butyl-2-(ethylamino)-4-hydroxy-6-methylpyrimidine |
| 2-ethylamino-6-methyl-5n-butyl-4-hydroxypyrimidine |
| 5-n-butyl-2-ethylamino-4-hydroxy-6-methyl-pyrimidine |
| 5-Butyl-2-(ethylamino)-6-methylpyrimidin-4(1H)-on |
| 2-ethylamino-4-methyl-5-n-butyl-6-hydroxypyrimidine |
| T6N CNJ BM2 DQ E4 F1 |
| 5-Butyl-2-(ethylamino)-6-methyl-4(1H)-pyrimidinone |
| Ethirimal |
| EINECS 245-949-3 |
| 4-Pyrimidinol, 5-butyl-2-(ethylamino)-6-methyl- |
| MILSTEM |
| 5-butyl-2-(ethylamino)-6-methylpyrimidin-4-ol |
| Ethyrimol |
| MFCD00055519 |
| Ethrimiol |
| 5-Butyl-2-(ethylamino)-6-methyl-4-pyrimidinol (8CI) |
| Milstem seed dressing |
| Milgo E |
| 5-butyl-2-(ethylamino)-6-methyl-1H-pyrimidin-4-one |
| Milgo |
| ethirimol |
| 5-butyl-2-ethylamino-6-methyl-3H-pyrimidin-4-one |
| T6VM DNJ CM2 E1 F4 |