DAPOA
Modify Date: 2024-04-05 22:50:18
DAPOA structure
|
Common Name | DAPOA | ||
|---|---|---|---|---|
| CAS Number | 2389064-43-9 | Molecular Weight | 200.16 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C5H8N6O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of DAPOADAPOA is a click chemistry reagent containing an azide group. DAPOA can be used in peptide synthesis as a linker that can be further modified at the azido-groups using Staudinger ligation or click-chemistry[1]. |
| Name | DAPOA |
|---|
| Description | DAPOA is a click chemistry reagent containing an azide group. DAPOA can be used in peptide synthesis as a linker that can be further modified at the azido-groups using Staudinger ligation or click-chemistry[1]. |
|---|---|
| Related Catalog |
| Molecular Formula | C5H8N6O3 |
|---|---|
| Molecular Weight | 200.16 |
| InChIKey | WDGRABVNFATWJY-UHFFFAOYSA-N |
| SMILES | [N-]=[N+]=NCC(CN=[N+]=[N-])OCC(=O)O |