1H-Indole-3-carboxylic acid, 4-chloro- structure
|
Common Name | 1H-Indole-3-carboxylic acid, 4-chloro- | ||
|---|---|---|---|---|
| CAS Number | 23872-36-8 | Molecular Weight | 195.602 | |
| Density | 1.5±0.1 g/cm3 | Boiling Point | 449.7±25.0 °C at 760 mmHg | |
| Molecular Formula | C9H6ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 225.8±23.2 °C | |
| Name | 4-chloro-1H-indole-3-carboxylic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.5±0.1 g/cm3 |
|---|---|
| Boiling Point | 449.7±25.0 °C at 760 mmHg |
| Molecular Formula | C9H6ClNO2 |
| Molecular Weight | 195.602 |
| Flash Point | 225.8±23.2 °C |
| Exact Mass | 195.008713 |
| PSA | 53.09000 |
| LogP | 2.58 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.728 |
| InChIKey | DRKHLIJRUYVIOY-UHFFFAOYSA-N |
| SMILES | O=C(O)c1c[nH]c2cccc(Cl)c12 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1H-Indole-3-carboxylic acid, 4-chloro- |
| 4-Chloro-1H-indole-3-carboxylic acid |
| 4-Chlor-3-carboxy-indol |
| 4-chloro-3-indolecarboxylic acid |
| 4-chloro-indole-3-carboxylic acid |