1-(p-Anisoyl)-1H-indazol-5-amine structure
|
Common Name | 1-(p-Anisoyl)-1H-indazol-5-amine | ||
|---|---|---|---|---|
| CAS Number | 23856-24-8 | Molecular Weight | 267.28300 | |
| Density | 1.31g/cm3 | Boiling Point | 524.9ºC at 760 mmHg | |
| Molecular Formula | C15H13N3O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 271.3ºC | |
| Name | (5-aminoindazol-1-yl)-(4-methoxyphenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.31g/cm3 |
|---|---|
| Boiling Point | 524.9ºC at 760 mmHg |
| Molecular Formula | C15H13N3O2 |
| Molecular Weight | 267.28300 |
| Flash Point | 271.3ºC |
| Exact Mass | 267.10100 |
| PSA | 70.14000 |
| LogP | 2.89680 |
| Vapour Pressure | 4.11E-11mmHg at 25°C |
| Index of Refraction | 1.657 |
| InChIKey | JCVZUVXLOGODKV-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)n2ncc3cc(N)ccc32)cc1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-(4'-Methoxybenzoyl)-5-aminoindazol |
| 1H-Indazol-5-amine,1-(p-methoxybenzoyl) |
| 1-(p-Methoxybenzoyl)-1H-indazol-5-amine |
| 1-(4-methoxy-benzoyl)-1H-indazol-5-ylamine |
| (5-amino-1h-indazol-1-yl)(4-methoxyphenyl)methanone |