4-chloro-8-(trifluoromethyl)quinoline
Modify Date: 2025-09-10 19:24:50
4-chloro-8-(trifluoromethyl)quinoline structure
|
Common Name | 4-chloro-8-(trifluoromethyl)quinoline | ||
|---|---|---|---|---|
| CAS Number | 23779-97-7 | Molecular Weight | 231.60200 | |
| Density | 1.427g/cm3 | Boiling Point | 265.5ºC at 760mmHg | |
| Molecular Formula | C10H5ClF3N | Melting Point | 80-82 °C(lit.) | |
| MSDS | N/A | Flash Point | 114.4ºC | |
| Name | 4-chloro-8-(trifluoromethyl)quinoline |
|---|---|
| Synonym | More Synonyms |
| Density | 1.427g/cm3 |
|---|---|
| Boiling Point | 265.5ºC at 760mmHg |
| Melting Point | 80-82 °C(lit.) |
| Molecular Formula | C10H5ClF3N |
| Molecular Weight | 231.60200 |
| Flash Point | 114.4ºC |
| Exact Mass | 231.00600 |
| PSA | 12.89000 |
| LogP | 3.90700 |
| Vapour Pressure | 0.0947mmHg at 25°C |
| Index of Refraction | 1.402 |
| InChIKey | LINGICLAECZKAW-UHFFFAOYSA-N |
| SMILES | FC(F)(F)c1cccc2c(Cl)ccnc12 |
| Hazard Codes | Xi: Irritant; |
|---|---|
| Risk Phrases | R36/37/38 |
| Safety Phrases | S26-S36 |
| WGK Germany | 3 |
| HS Code | 2933499090 |
|
~%
4-chloro-8-(tri... CAS#:23779-97-7 |
| Literature: US4277607 A1, ; |
|
~%
4-chloro-8-(tri... CAS#:23779-97-7 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 15, # 4 p. 1015 - 1018 |
|
~%
4-chloro-8-(tri... CAS#:23779-97-7 |
| Literature: Bioorganic and Medicinal Chemistry Letters, , vol. 15, # 4 p. 1015 - 1018 |
![2,2-dimethyl-5-{([2-(trifluoromethyl)phenyl]amino)methylene}-1,3-dioxane-4,6-dione structure](https://image.chemsrc.com/caspic/245/450383-19-4.png)
CAS#:57369-92-3
CAS#:23779-99-9| HS Code | 2933499090 |
|---|---|
| Summary | 2933499090. other compounds containing in the structure a quinoline or isoquinoline ring-system (whether or not hydrogenated), not further fused. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-Chlor-8-trifluormethyl-chinolin |
| 4-chloro-8-trifluoromethyl-quinoline |
| EINECS 245-880-9 |
| MFCD00134578 |